C12H14ClFN2O2S — CID 8794996
4-chloro-N-[(2S)-2-cyano-3-methylbutan-2-yl]-2-fluorobenzenesulfonamide (PubChem CID 8794996) has the molecular formula C12H14ClFN2O2S and a molecular weight of 304.77 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-2-cyano-3-methylbutan-2-yl]-2-fluorobenzenesulfonamide.
| Compound Name | 4-chloro-N-[(2S)-2-cyano-3-methylbutan-2-yl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 8794996 |
| Molecular Formula | C12H14ClFN2O2S |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 4-chloro-N-[(2S)-2-cyano-3-methylbutan-2-yl]-2-fluorobenzenesulfonamide |
| SMILES | CC(C)[C@@](C)(C#N)NS(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H14ClFN2O2S/c1-8(2)12(3,7-15)16-19(17,18)11-5-4-9(13)6-10(11)14/h4-6,8,16H,1-3H3/t12-/m1/s1 |
| InChIKey | QERMRWNLEYLYMR-GFCCVEGCSA-N |
| XLogP | 2.70 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |