C7H9F6NO6S — CID 87783255
2,2,2-trifluoroacetic acid;4-(trifluoromethylsulfonylamino)butanoic acid (PubChem CID 87783255) has the molecular formula C7H9F6NO6S and a molecular weight of 349.21 g/mol. Its IUPAC name is 2,2,2-trifluoroacetic acid;4-(trifluoromethylsulfonylamino)butanoic acid.
| Compound Name | 2,2,2-trifluoroacetic acid;4-(trifluoromethylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 87783255 |
| Molecular Formula | C7H9F6NO6S |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2,2,2-trifluoroacetic acid;4-(trifluoromethylsulfonylamino)butanoic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCCNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H8F3NO4S.C2HF3O2/c6-5(7,8)14(12,13)9-3-1-2-4(10)11;3-2(4,5)1(6)7/h9H,1-3H2,(H,10,11);(H,6,7) |
| InChIKey | VDQCKHDATPGVKL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|