C24H28N6O8 — CID 87785258
4-hydroxy-5-methoxy-2-nitrobenzonitrile;5-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]-2-nitrobenzonitrile (PubChem CID 87785258) has the molecular formula C24H28N6O8 and a molecular weight of 528.52 g/mol. Its IUPAC name is 4-hydroxy-5-methoxy-2-nitrobenzonitrile;5-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]-2-nitrobenzonitrile.
| Compound Name | 4-hydroxy-5-methoxy-2-nitrobenzonitrile;5-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 87785258 |
| Molecular Formula | C24H28N6O8 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 4-hydroxy-5-methoxy-2-nitrobenzonitrile;5-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]-2-nitrobenzonitrile |
| SMILES | COc1cc(C#N)c([N+](=O)[O-])cc1O.COc1cc(C#N)c([N+](=O)[O-])cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C16H22N4O4.C8H6N2O4/c1-18-5-7-19(8-6-18)4-3-9-24-16-11-14(20(21)22)13(12-17)10-15(16)23-2;1-14-8-2-5(4-9)6(10(12)13)3-7(8)11/h10-11H,3-9H2,1-2H3;2-3,11H,1H3 |
| InChIKey | JYHVRIJWFZOBFR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 188.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|