C27H23AsClN7 — CID 87785660
CID 87785660 (PubChem CID 87785660) has the molecular formula C27H23AsClN7 and a molecular weight of 555.91 g/mol.
| Compound Name | CID 87785660 |
|---|---|
| PubChem CID | 87785660 |
| Molecular Formula | C27H23AsClN7 |
| Molecular Weight | 555.91 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | — |
| SMILES | Clc1cc2ccc(-c3ccccn3)nc2cc1-c1nn(C2CC(CN3CCC3)C2)c2ncnc([As])c12 |
| InChI | InChI=1S/C27H23AsClN7/c28-26-24-25(34-36(27(24)32-15-31-26)18-10-16(11-18)14-35-8-3-9-35)19-13-23-17(12-20(19)29)5-6-22(33-23)21-4-1-2-7-30-21/h1-2,4-7,12-13,15-16,18H,3,8-11,14H2 |
| InChIKey | KGOWQWULSQLHOE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.91 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|