C27H24AsClN7 — CID 87785661
CID 87785661 (PubChem CID 87785661) has the molecular formula C27H24AsClN7 and a molecular weight of 556.91 g/mol.
| Compound Name | CID 87785661 |
|---|---|
| PubChem CID | 87785661 |
| Molecular Formula | C27H24AsClN7 |
| Molecular Weight | 556.91 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | — |
| SMILES | Clc1cc2ccc(-c3ccccn3)nc2cc1-c1[nH]nc2ncnc([As]C3CC(CN4CCC4)C3)c12 |
| InChI | InChI=1S/C27H24AsClN7/c29-20-12-17-5-6-22(21-4-1-2-7-30-21)33-23(17)13-19(20)25-24-26(31-15-32-27(24)35-34-25)28-18-10-16(11-18)14-36-8-3-9-36/h1-2,4-7,12-13,15-16,18H,3,8-11,14H2,(H,31,32,34,35) |
| InChIKey | AJYSWQKERVGAFN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.91 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|