About dichloropalladium;phenylphosphane
dichloropalladium;phenylphosphane (PubChem CID 87787995) has the molecular formula C12H14Cl2P2Pd
and a molecular weight of 397.52 g/mol. Its IUPAC name is dichloropalladium;phenylphosphane.
Molecular Properties
| Compound Name | dichloropalladium;phenylphosphane |
| PubChem CID | 87787995 |
| Molecular Formula | C12H14Cl2P2Pd |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 395.90 |
| IUPAC Name | dichloropalladium;phenylphosphane |
| SMILES | Cl[Pd]Cl.Pc1ccccc1.Pc1ccccc1 |
| InChI | InChI=1S/2C6H7P.2ClH.Pd/c2*7-6-4-2-1-3-5-6;;;/h2*1-5H,7H2;2*1H;/q;;;;+2/p-2 |
| InChIKey | IBJWDIANWSLEDQ-UHFFFAOYSA-L |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloropalladium;phenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloropalladium;phenylphosphane?
The IUPAC name of dichloropalladium;phenylphosphane (CID 87787995) is dichloropalladium;phenylphosphane.
What is the SMILES notation for dichloropalladium;phenylphosphane?
The canonical SMILES for dichloropalladium;phenylphosphane is Cl[Pd]Cl.Pc1ccccc1.Pc1ccccc1.
What is the InChIKey of dichloropalladium;phenylphosphane?
The InChIKey is IBJWDIANWSLEDQ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H7P.2ClH.Pd/c2*7-6-4-2-1-3-5-6;;;/h2*1-5H,7H2;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloropalladium;phenylphosphane?
dichloropalladium;phenylphosphane has a molecular weight of 397.52 g/mol, XLogP of 3.75, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloropalladium;phenylphosphane is sourced from PubChem (CID 87787995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).