C17H25N3O5S — CID 87788117
N-[(2S)-1-[2-[(3-methoxy-4-prop-2-ynoxyphenyl)methyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]methanesulfonamide (PubChem CID 87788117) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[(2S)-1-[2-[(3-methoxy-4-prop-2-ynoxyphenyl)methyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]methanesulfonamide.
| Compound Name | N-[(2S)-1-[2-[(3-methoxy-4-prop-2-ynoxyphenyl)methyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 87788117 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[(2S)-1-[2-[(3-methoxy-4-prop-2-ynoxyphenyl)methyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]methanesulfonamide |
| SMILES | C#CCOc1ccc(CNNC(=O)[C@@H](NS(C)(=O)=O)C(C)C)cc1OC |
| InChI | InChI=1S/C17H25N3O5S/c1-6-9-25-14-8-7-13(10-15(14)24-4)11-18-19-17(21)16(12(2)3)20-26(5,22)23/h1,7-8,10,12,16,18,20H,9,11H2,2-5H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | KSGYVWPWPIJIPU-INIZCTEOSA-N |
| XLogP | 0.40 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|