About [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate
[(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate (PubChem CID 8779173) has the molecular formula C16H17N3O3
and a molecular weight of 299.33 g/mol. Its IUPAC name is [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate.
Molecular Properties
| Compound Name | [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate |
| PubChem CID | 8779173 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate |
| SMILES | CC(C)Oc1cccc(C(=O)O/N=C(/N)c2cccnc2)c1 |
| InChI | InChI=1S/C16H17N3O3/c1-11(2)21-14-7-3-5-12(9-14)16(20)22-19-15(17)13-6-4-8-18-10-13/h3-11H,1-2H3,(H2,17,19) |
| InChIKey | SSDMCIWSMRDIDP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate?
The IUPAC name of [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate (CID 8779173) is [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate.
What is the SMILES notation for [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate?
The canonical SMILES for [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate is CC(C)Oc1cccc(C(=O)O/N=C(/N)c2cccnc2)c1.
What is the InChIKey of [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate?
The InChIKey is SSDMCIWSMRDIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3/c1-11(2)21-14-7-3-5-12(9-14)16(20)22-19-15(17)13-6-4-8-18-10-13/h3-11H,1-2H3,(H2,17,19).
What are the key properties of [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate?
[(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate has a molecular weight of 299.33 g/mol, XLogP of 2.35, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[amino(pyridin-3-yl)methylidene]amino] 3-propan-2-yloxybenzoate is sourced from PubChem (CID 8779173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).