About 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol
2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol (PubChem CID 87792437) has the molecular formula C10H14S3
and a molecular weight of 230.42 g/mol. Its IUPAC name is 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol.
Molecular Properties
| Compound Name | 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol |
| PubChem CID | 87792437 |
| Molecular Formula | C10H14S3 |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol |
| SMILES | CSc1ccc(CCS)cc1SC |
| InChI | InChI=1S/C10H14S3/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7,11H,5-6H2,1-2H3 |
| InChIKey | VGIJOZGFCYZILF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol?
The IUPAC name of 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol (CID 87792437) is 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol.
What is the SMILES notation for 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol?
The canonical SMILES for 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol is CSc1ccc(CCS)cc1SC.
What is the InChIKey of 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol?
The InChIKey is VGIJOZGFCYZILF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S3/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7,11H,5-6H2,1-2H3.
What are the key properties of 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol?
2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol has a molecular weight of 230.42 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4-bis(methylsulfanyl)phenyl]ethanethiol is sourced from PubChem (CID 87792437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).