C18H36O4 — CID 87794362
2-butyl-1,1-bis(tert-butylperoxy)cyclohexane (PubChem CID 87794362) has the molecular formula C18H36O4 and a molecular weight of 316.48 g/mol. Its IUPAC name is 2-butyl-1,1-bis(tert-butylperoxy)cyclohexane.
| Compound Name | 2-butyl-1,1-bis(tert-butylperoxy)cyclohexane |
|---|---|
| PubChem CID | 87794362 |
| Molecular Formula | C18H36O4 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 2-butyl-1,1-bis(tert-butylperoxy)cyclohexane |
| SMILES | CCCCC1CCCCC1(OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C18H36O4/c1-8-9-12-15-13-10-11-14-18(15,21-19-16(2,3)4)22-20-17(5,6)7/h15H,8-14H2,1-7H3 |
| InChIKey | FUQYSRIJSFLKGY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|