C17H24ClN5O5 — CID 87794572
N-[2-chloro-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]heptanamide (PubChem CID 87794572) has the molecular formula C17H24ClN5O5 and a molecular weight of 413.86 g/mol. Its IUPAC name is N-[2-chloro-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]heptanamide.
| Compound Name | N-[2-chloro-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]heptanamide |
|---|---|
| PubChem CID | 87794572 |
| Molecular Formula | C17H24ClN5O5 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[2-chloro-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1nc(Cl)nc2c1ncn2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C17H24ClN5O5/c1-2-3-4-5-6-10(25)20-14-11-15(22-17(18)21-14)23(8-19-11)16-13(27)12(26)9(7-24)28-16/h8-9,12-13,16,24,26-27H,2-7H2,1H3,(H,20,21,22,25) |
| InChIKey | VAEJLFDZANASKQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|