C13H26F3NO — CID 87795847
3-(dipentylamino)-1,1,1-trifluoropropan-2-ol (PubChem CID 87795847) has the molecular formula C13H26F3NO and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-(dipentylamino)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(dipentylamino)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 87795847 |
| Molecular Formula | C13H26F3NO |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 3-(dipentylamino)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCCCCN(CCCCC)CC(O)C(F)(F)F |
| InChI | InChI=1S/C13H26F3NO/c1-3-5-7-9-17(10-8-6-4-2)11-12(18)13(14,15)16/h12,18H,3-11H2,1-2H3 |
| InChIKey | NTVPESPEALBMLB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|