C10H10ClN3O — CID 87801663
4-chloro-7-propan-2-ylpyrrolo[2,3-d]pyrimidine-5-carbaldehyde (PubChem CID 87801663) has the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. Its IUPAC name is 4-chloro-7-propan-2-ylpyrrolo[2,3-d]pyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-7-propan-2-ylpyrrolo[2,3-d]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 87801663 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 4-chloro-7-propan-2-ylpyrrolo[2,3-d]pyrimidine-5-carbaldehyde |
| SMILES | CC(C)n1cc(C=O)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C10H10ClN3O/c1-6(2)14-3-7(4-15)8-9(11)12-5-13-10(8)14/h3-6H,1-2H3 |
| InChIKey | SVIHVYATTOOYPP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|