C38H44N2O8S — CID 87802355
[4-[4-[benzyl-[(2S)-2-hydroxy-3-[3-(methanesulfonamido)-4-phenylmethoxyphenoxy]propyl]amino]cyclohexyl]phenyl] ethaneperoxoate (PubChem CID 87802355) has the molecular formula C38H44N2O8S and a molecular weight of 688.84 g/mol. Its IUPAC name is [4-[4-[benzyl-[(2S)-2-hydroxy-3-[3-(methanesulfonamido)-4-phenylmethoxyphenoxy]propyl]amino]cyclohexyl]phenyl] ethaneperoxoate.
| Compound Name | [4-[4-[benzyl-[(2S)-2-hydroxy-3-[3-(methanesulfonamido)-4-phenylmethoxyphenoxy]propyl]amino]cyclohexyl]phenyl] ethaneperoxoate |
|---|---|
| PubChem CID | 87802355 |
| Molecular Formula | C38H44N2O8S |
| Molecular Weight | 688.84 g/mol |
| Exact Mass | 688.28 |
| IUPAC Name | [4-[4-[benzyl-[(2S)-2-hydroxy-3-[3-(methanesulfonamido)-4-phenylmethoxyphenoxy]propyl]amino]cyclohexyl]phenyl] ethaneperoxoate |
| SMILES | CC(=O)OOc1ccc(C2CCC(N(Cc3ccccc3)C[C@H](O)COc3ccc(OCc4ccccc4)c(NS(C)(=O)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C38H44N2O8S/c1-28(41)47-48-35-19-15-32(16-20-35)31-13-17-33(18-14-31)40(24-29-9-5-3-6-10-29)25-34(42)27-45-36-21-22-38(37(23-36)39-49(2,43)44)46-26-30-11-7-4-8-12-30/h3-12,15-16,19-23,31,33-34,39,42H,13-14,17-18,24-27H2,1-2H3/t31?,33?,34-/m0/s1 |
| InChIKey | OJKMTANKYQAKRN-PHKKBQGMSA-N |
| XLogP | 6.46 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.84 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|