C11H13N3O3S2 — CID 87804668
(2E)-3-methyl-2-(propan-2-ylidenehydrazinylidene)-1,3-benzothiazole-7-sulfonic acid (PubChem CID 87804668) has the molecular formula C11H13N3O3S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is (2E)-3-methyl-2-(propan-2-ylidenehydrazinylidene)-1,3-benzothiazole-7-sulfonic acid.
| Compound Name | (2E)-3-methyl-2-(propan-2-ylidenehydrazinylidene)-1,3-benzothiazole-7-sulfonic acid |
|---|---|
| PubChem CID | 87804668 |
| Molecular Formula | C11H13N3O3S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (2E)-3-methyl-2-(propan-2-ylidenehydrazinylidene)-1,3-benzothiazole-7-sulfonic acid |
| SMILES | CC(C)=N/N=c1/sc2c(S(=O)(=O)O)cccc2n1C |
| InChI | InChI=1S/C11H13N3O3S2/c1-7(2)12-13-11-14(3)8-5-4-6-9(10(8)18-11)19(15,16)17/h4-6H,1-3H3,(H,15,16,17)/b13-11+ |
| InChIKey | YEJUZBUBRIRPAG-ACCUITESSA-N |
| XLogP | 1.78 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|