C14H12ClN3S2 — CID 3342037
N-[1-(5-chlorothiophen-2-yl)ethylideneamino]-3-methyl-1,3-benzothiazol-2-imine (PubChem CID 3342037) has the molecular formula C14H12ClN3S2 and a molecular weight of 321.86 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethylideneamino]-3-methyl-1,3-benzothiazol-2-imine.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethylideneamino]-3-methyl-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 3342037 |
| Molecular Formula | C14H12ClN3S2 |
| Molecular Weight | 321.86 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethylideneamino]-3-methyl-1,3-benzothiazol-2-imine |
| SMILES | CC(=NN=c1sc2ccccc2n1C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H12ClN3S2/c1-9(11-7-8-13(15)19-11)16-17-14-18(2)10-5-3-4-6-12(10)20-14/h3-8H,1-2H3 |
| InChIKey | WYURTZWEGMTHHO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.86 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|