C16H22N2O2S2 — CID 87805860
[1-(2-morpholin-4-ylethylamino)-1-oxopropan-2-yl] benzenecarbodithioate (PubChem CID 87805860) has the molecular formula C16H22N2O2S2 and a molecular weight of 338.50 g/mol. Its IUPAC name is [1-(2-morpholin-4-ylethylamino)-1-oxopropan-2-yl] benzenecarbodithioate.
| Compound Name | [1-(2-morpholin-4-ylethylamino)-1-oxopropan-2-yl] benzenecarbodithioate |
|---|---|
| PubChem CID | 87805860 |
| Molecular Formula | C16H22N2O2S2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | [1-(2-morpholin-4-ylethylamino)-1-oxopropan-2-yl] benzenecarbodithioate |
| SMILES | CC(SC(=S)c1ccccc1)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C16H22N2O2S2/c1-13(22-16(21)14-5-3-2-4-6-14)15(19)17-7-8-18-9-11-20-12-10-18/h2-6,13H,7-12H2,1H3,(H,17,19) |
| InChIKey | AIQQHJKINKLLJG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|