C21H28ClNO3S — CID 87806263
3-[(2S)-2-(3-chlorophenyl)propyl]-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioic S-acid (PubChem CID 87806263) has the molecular formula C21H28ClNO3S and a molecular weight of 409.98 g/mol. Its IUPAC name is 3-[(2S)-2-(3-chlorophenyl)propyl]-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioic S-acid.
| Compound Name | 3-[(2S)-2-(3-chlorophenyl)propyl]-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioic S-acid |
|---|---|
| PubChem CID | 87806263 |
| Molecular Formula | C21H28ClNO3S |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-[(2S)-2-(3-chlorophenyl)propyl]-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioic S-acid |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCC(C[C@H](C)c2cccc(Cl)c2)C1C(=O)S |
| InChI | InChI=1S/C21H28ClNO3S/c1-5-21(3,4)18(24)19(25)23-10-9-15(17(23)20(26)27)11-13(2)14-7-6-8-16(22)12-14/h6-8,12-13,15,17H,5,9-11H2,1-4H3,(H,26,27)/t13-,15?,17?/m0/s1 |
| InChIKey | CADWUGQMFGWCBQ-KTAKPFMOSA-N |
| XLogP | 4.51 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|