C19H20ClN3O4S — CID 87811975
2-[5-[1-(2-chlorobenzoyl)piperidin-4-ylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-ethylacetamide (PubChem CID 87811975) has the molecular formula C19H20ClN3O4S and a molecular weight of 421.91 g/mol. Its IUPAC name is 2-[5-[1-(2-chlorobenzoyl)piperidin-4-ylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-ethylacetamide.
| Compound Name | 2-[5-[1-(2-chlorobenzoyl)piperidin-4-ylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 87811975 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-[5-[1-(2-chlorobenzoyl)piperidin-4-ylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)CN1C(=O)SC(=C2CCN(C(=O)c3ccccc3Cl)CC2)C1=O |
| InChI | InChI=1S/C19H20ClN3O4S/c1-2-21-15(24)11-23-18(26)16(28-19(23)27)12-7-9-22(10-8-12)17(25)13-5-3-4-6-14(13)20/h3-6H,2,7-11H2,1H3,(H,21,24) |
| InChIKey | ABVOHFUNUFKYSI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|