C32H24N4O4S3 — CID 87813326
[4-[[4-methyl-3-[4-pyridin-3-yl-N-(1,3-thiazol-2-yl)anilino]phenyl]carbamoyl]phenyl] thiophene-2-sulfonate (PubChem CID 87813326) has the molecular formula C32H24N4O4S3 and a molecular weight of 624.77 g/mol. Its IUPAC name is [4-[[4-methyl-3-[4-pyridin-3-yl-N-(1,3-thiazol-2-yl)anilino]phenyl]carbamoyl]phenyl] thiophene-2-sulfonate.
| Compound Name | [4-[[4-methyl-3-[4-pyridin-3-yl-N-(1,3-thiazol-2-yl)anilino]phenyl]carbamoyl]phenyl] thiophene-2-sulfonate |
|---|---|
| PubChem CID | 87813326 |
| Molecular Formula | C32H24N4O4S3 |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | [4-[[4-methyl-3-[4-pyridin-3-yl-N-(1,3-thiazol-2-yl)anilino]phenyl]carbamoyl]phenyl] thiophene-2-sulfonate |
| SMILES | Cc1ccc(NC(=O)c2ccc(OS(=O)(=O)c3cccs3)cc2)cc1N(c1ccc(-c2cccnc2)cc1)c1nccs1 |
| InChI | InChI=1S/C32H24N4O4S3/c1-22-6-11-26(35-31(37)24-9-14-28(15-10-24)40-43(38,39)30-5-3-18-41-30)20-29(22)36(32-34-17-19-42-32)27-12-7-23(8-13-27)25-4-2-16-33-21-25/h2-21H,1H3,(H,35,37) |
| InChIKey | RLHPTULEVFKPHM-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|