About (4-benzamidophenyl) thiophene-2-sulfonate
(4-benzamidophenyl) thiophene-2-sulfonate (PubChem CID 32937824) has the molecular formula C17H13NO4S2
and a molecular weight of 359.43 g/mol. Its IUPAC name is (4-benzamidophenyl) thiophene-2-sulfonate.
Molecular Properties
| Compound Name | (4-benzamidophenyl) thiophene-2-sulfonate |
| PubChem CID | 32937824 |
| Molecular Formula | C17H13NO4S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | (4-benzamidophenyl) thiophene-2-sulfonate |
| SMILES | O=C(Nc1ccc(OS(=O)(=O)c2cccs2)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H13NO4S2/c19-17(13-5-2-1-3-6-13)18-14-8-10-15(11-9-14)22-24(20,21)16-7-4-12-23-16/h1-12H,(H,18,19) |
| InChIKey | KQXUFLSTZCPLKK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-benzamidophenyl) thiophene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzamidophenyl) thiophene-2-sulfonate?
The IUPAC name of (4-benzamidophenyl) thiophene-2-sulfonate (CID 32937824) is (4-benzamidophenyl) thiophene-2-sulfonate.
What is the SMILES notation for (4-benzamidophenyl) thiophene-2-sulfonate?
The canonical SMILES for (4-benzamidophenyl) thiophene-2-sulfonate is O=C(Nc1ccc(OS(=O)(=O)c2cccs2)cc1)c1ccccc1.
What is the InChIKey of (4-benzamidophenyl) thiophene-2-sulfonate?
The InChIKey is KQXUFLSTZCPLKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO4S2/c19-17(13-5-2-1-3-6-13)18-14-8-10-15(11-9-14)22-24(20,21)16-7-4-12-23-16/h1-12H,(H,18,19).
What are the key properties of (4-benzamidophenyl) thiophene-2-sulfonate?
(4-benzamidophenyl) thiophene-2-sulfonate has a molecular weight of 359.43 g/mol, XLogP of 3.77, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzamidophenyl) thiophene-2-sulfonate is sourced from PubChem (CID 32937824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).