C20H21NO5 — CID 87813612
2-benzyl-4-oxo-2-[(2-oxo-2-phenylmethoxyethyl)amino]butanoic acid (PubChem CID 87813612) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-benzyl-4-oxo-2-[(2-oxo-2-phenylmethoxyethyl)amino]butanoic acid.
| Compound Name | 2-benzyl-4-oxo-2-[(2-oxo-2-phenylmethoxyethyl)amino]butanoic acid |
|---|---|
| PubChem CID | 87813612 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-benzyl-4-oxo-2-[(2-oxo-2-phenylmethoxyethyl)amino]butanoic acid |
| SMILES | O=CCC(Cc1ccccc1)(NCC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H21NO5/c22-12-11-20(19(24)25,13-16-7-3-1-4-8-16)21-14-18(23)26-15-17-9-5-2-6-10-17/h1-10,12,21H,11,13-15H2,(H,24,25) |
| InChIKey | RTOHFBQKOJXZDL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|