C26H24ClN3O6S2 — CID 87813909
2-[(4-chloro-N-methylanilino)-[[3-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]amino]-2-sulfonylacetic acid (PubChem CID 87813909) has the molecular formula C26H24ClN3O6S2 and a molecular weight of 574.08 g/mol. Its IUPAC name is 2-[(4-chloro-N-methylanilino)-[[3-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]amino]-2-sulfonylacetic acid.
| Compound Name | 2-[(4-chloro-N-methylanilino)-[[3-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]amino]-2-sulfonylacetic acid |
|---|---|
| PubChem CID | 87813909 |
| Molecular Formula | C26H24ClN3O6S2 |
| Molecular Weight | 574.08 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | 2-[(4-chloro-N-methylanilino)-[[3-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]amino]-2-sulfonylacetic acid |
| SMILES | Cc1oc(-c2cccs2)nc1CCOc1cccc(CN(C(C(=O)O)=S(=O)=O)N(C)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C26H24ClN3O6S2/c1-17-22(28-24(36-17)23-7-4-14-37-23)12-13-35-21-6-3-5-18(15-21)16-30(25(26(31)32)38(33)34)29(2)20-10-8-19(27)9-11-20/h3-11,14-15H,12-13,16H2,1-2H3,(H,31,32) |
| InChIKey | SYMZYMGYTQTLFD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.08 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|