C21H25N3O6S2 — CID 87798228
[dimethylsulfamoyl-[[3-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]amino] acetate (PubChem CID 87798228) has the molecular formula C21H25N3O6S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is [dimethylsulfamoyl-[[3-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]amino] acetate.
| Compound Name | [dimethylsulfamoyl-[[3-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]amino] acetate |
|---|---|
| PubChem CID | 87798228 |
| Molecular Formula | C21H25N3O6S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [dimethylsulfamoyl-[[3-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]amino] acetate |
| SMILES | CC(=O)ON(Cc1cccc(OCCc2nc(-c3cccs3)oc2C)c1)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C21H25N3O6S2/c1-15-19(22-21(29-15)20-9-6-12-31-20)10-11-28-18-8-5-7-17(13-18)14-24(30-16(2)25)32(26,27)23(3)4/h5-9,12-13H,10-11,14H2,1-4H3 |
| InChIKey | YSORMSDLWODKMU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|