C29H31N3O6S — CID 91040362
[[3-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]phenyl]methyl-[(4-methylphenyl)sulfamoyl]amino] acetate (PubChem CID 91040362) has the molecular formula C29H31N3O6S and a molecular weight of 549.65 g/mol. Its IUPAC name is [[3-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]phenyl]methyl-[(4-methylphenyl)sulfamoyl]amino] acetate.
| Compound Name | [[3-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]phenyl]methyl-[(4-methylphenyl)sulfamoyl]amino] acetate |
|---|---|
| PubChem CID | 91040362 |
| Molecular Formula | C29H31N3O6S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | [[3-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]phenyl]methyl-[(4-methylphenyl)sulfamoyl]amino] acetate |
| SMILES | CC(=O)ON(Cc1cccc(OCCc2nc(-c3ccc(C)cc3)oc2C)c1)S(=O)(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C29H31N3O6S/c1-20-8-12-25(13-9-20)29-30-28(22(3)37-29)16-17-36-27-7-5-6-24(18-27)19-32(38-23(4)33)39(34,35)31-26-14-10-21(2)11-15-26/h5-15,18,31H,16-17,19H2,1-4H3 |
| InChIKey | SMACANKYEFWJHD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|