C27H28AsN3O3 — CID 87815749
N-[2-[methyl(1-pyrrolidin-3-ylethyl)arsanyl]-1,3-benzoxazol-5-yl]-3-phenoxybenzamide (PubChem CID 87815749) has the molecular formula C27H28AsN3O3 and a molecular weight of 517.46 g/mol. Its IUPAC name is N-[2-[methyl(1-pyrrolidin-3-ylethyl)arsanyl]-1,3-benzoxazol-5-yl]-3-phenoxybenzamide.
| Compound Name | N-[2-[methyl(1-pyrrolidin-3-ylethyl)arsanyl]-1,3-benzoxazol-5-yl]-3-phenoxybenzamide |
|---|---|
| PubChem CID | 87815749 |
| Molecular Formula | C27H28AsN3O3 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | N-[2-[methyl(1-pyrrolidin-3-ylethyl)arsanyl]-1,3-benzoxazol-5-yl]-3-phenoxybenzamide |
| SMILES | CC(C1CCNC1)[As](C)c1nc2cc(NC(=O)c3cccc(Oc4ccccc4)c3)ccc2o1 |
| InChI | InChI=1S/C27H28AsN3O3/c1-18(20-13-14-29-17-20)28(2)27-31-24-16-21(11-12-25(24)34-27)30-26(32)19-7-6-10-23(15-19)33-22-8-4-3-5-9-22/h3-12,15-16,18,20,29H,13-14,17H2,1-2H3,(H,30,32) |
| InChIKey | RKQXFKVDDTTWIL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|