C44H68N2 — CID 87817120
[3-butyl-2,5-bis(3,5-dibutyl-4-methylphenyl)-4-hexylpyrrol-1-ium-1-ylidene]azanide (PubChem CID 87817120) has the molecular formula C44H68N2 and a molecular weight of 625.04 g/mol. Its IUPAC name is [3-butyl-2,5-bis(3,5-dibutyl-4-methylphenyl)-4-hexylpyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [3-butyl-2,5-bis(3,5-dibutyl-4-methylphenyl)-4-hexylpyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87817120 |
| Molecular Formula | C44H68N2 |
| Molecular Weight | 625.04 g/mol |
| Exact Mass | 624.54 |
| IUPAC Name | [3-butyl-2,5-bis(3,5-dibutyl-4-methylphenyl)-4-hexylpyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCC1=C(c2cc(CCCC)c(C)c(CCCC)c2)[N+](=[N-])C(c2cc(CCCC)c(C)c(CCCC)c2)=C1CCCC |
| InChI | InChI=1S/C44H68N2/c1-9-15-21-22-28-42-41(27-20-14-6)43(39-29-35(23-16-10-2)33(7)36(30-39)24-17-11-3)46(45)44(42)40-31-37(25-18-12-4)34(8)38(32-40)26-19-13-5/h29-32H,9-28H2,1-8H3 |
| InChIKey | YJXOQWJFMUAKEL-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.04 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|