C34H48N2 — CID 87819847
[3-butyl-4-octyl-2,5-bis(3,4,5-trimethylphenyl)pyrrol-1-ium-1-ylidene]azanide (PubChem CID 87819847) has the molecular formula C34H48N2 and a molecular weight of 484.77 g/mol. Its IUPAC name is [3-butyl-4-octyl-2,5-bis(3,4,5-trimethylphenyl)pyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [3-butyl-4-octyl-2,5-bis(3,4,5-trimethylphenyl)pyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87819847 |
| Molecular Formula | C34H48N2 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.38 |
| IUPAC Name | [3-butyl-4-octyl-2,5-bis(3,4,5-trimethylphenyl)pyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCCCC1=C(c2cc(C)c(C)c(C)c2)[N+](=[N-])C(c2cc(C)c(C)c(C)c2)=C1CCCC |
| InChI | InChI=1S/C34H48N2/c1-9-11-13-14-15-16-18-32-31(17-12-10-2)33(29-19-23(3)27(7)24(4)20-29)36(35)34(32)30-21-25(5)28(8)26(6)22-30/h19-22H,9-18H2,1-8H3 |
| InChIKey | OZEFJYCLGBOMAN-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|