C50H80N2Ni — CID 87818858
[3-butyl-2,5-bis(3-hexyl-5-pentylphenyl)-4-octylpyrrol-1-ium-1-ylidene]azanide;nickel (PubChem CID 87818858) has the molecular formula C50H80N2Ni and a molecular weight of 767.90 g/mol. Its IUPAC name is [3-butyl-2,5-bis(3-hexyl-5-pentylphenyl)-4-octylpyrrol-1-ium-1-ylidene]azanide;nickel.
| Compound Name | [3-butyl-2,5-bis(3-hexyl-5-pentylphenyl)-4-octylpyrrol-1-ium-1-ylidene]azanide;nickel |
|---|---|
| PubChem CID | 87818858 |
| Molecular Formula | C50H80N2Ni |
| Molecular Weight | 767.90 g/mol |
| Exact Mass | 766.57 |
| IUPAC Name | [3-butyl-2,5-bis(3-hexyl-5-pentylphenyl)-4-octylpyrrol-1-ium-1-ylidene]azanide;nickel |
| SMILES | CCCCCCCCC1=C(c2cc(CCCCC)cc(CCCCCC)c2)[N+](=[N-])C(c2cc(CCCCC)cc(CCCCCC)c2)=C1CCCC.[Ni] |
| InChI | InChI=1S/C50H80N2.Ni/c1-7-13-19-22-23-28-34-48-47(33-18-12-6)49(45-37-41(29-24-16-10-4)35-43(39-45)31-26-20-14-8-2)52(51)50(48)46-38-42(30-25-17-11-5)36-44(40-46)32-27-21-15-9-3;/h35-40H,7-34H2,1-6H3; |
| InChIKey | QBMPRFUDLMHOFN-UHFFFAOYSA-N |
| XLogP | 16.51 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 30 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.90 |
| LogP ≤ 5 | 16.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|