C58H96N2 — CID 87819932
[3-butyl-2,5-bis(3,5-dioctylphenyl)-4-hexylpyrrol-1-ium-1-ylidene]azanide (PubChem CID 87819932) has the molecular formula C58H96N2 and a molecular weight of 821.42 g/mol. Its IUPAC name is [3-butyl-2,5-bis(3,5-dioctylphenyl)-4-hexylpyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [3-butyl-2,5-bis(3,5-dioctylphenyl)-4-hexylpyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87819932 |
| Molecular Formula | C58H96N2 |
| Molecular Weight | 821.42 g/mol |
| Exact Mass | 820.76 |
| IUPAC Name | [3-butyl-2,5-bis(3,5-dioctylphenyl)-4-hexylpyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCCCc1cc(CCCCCCCC)cc(C2=C(CCCC)C(CCCCCC)=C(c3cc(CCCCCCCC)cc(CCCCCCCC)c3)[N+]2=[N-])c1 |
| InChI | InChI=1S/C58H96N2/c1-7-13-19-24-28-32-37-49-43-50(38-33-29-25-20-14-8-2)46-53(45-49)57-55(41-18-12-6)56(42-36-23-17-11-5)58(60(57)59)54-47-51(39-34-30-26-21-15-9-3)44-52(48-54)40-35-31-27-22-16-10-4/h43-48H,7-42H2,1-6H3 |
| InChIKey | HKQNTYCEIZOGQQ-UHFFFAOYSA-N |
| XLogP | 19.63 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 38 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.42 |
| LogP ≤ 5 | 19.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|