C46H72N2 — CID 87819713
[3-butyl-2,5-bis(3,5-dihexylphenyl)-4-ethylpyrrol-1-ium-1-ylidene]azanide (PubChem CID 87819713) has the molecular formula C46H72N2 and a molecular weight of 653.10 g/mol. Its IUPAC name is [3-butyl-2,5-bis(3,5-dihexylphenyl)-4-ethylpyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [3-butyl-2,5-bis(3,5-dihexylphenyl)-4-ethylpyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87819713 |
| Molecular Formula | C46H72N2 |
| Molecular Weight | 653.10 g/mol |
| Exact Mass | 652.57 |
| IUPAC Name | [3-butyl-2,5-bis(3,5-dihexylphenyl)-4-ethylpyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCc1cc(CCCCCC)cc(C2=C(CC)C(CCCC)=C(c3cc(CCCCCC)cc(CCCCCC)c3)[N+]2=[N-])c1 |
| InChI | InChI=1S/C46H72N2/c1-7-13-18-22-26-37-31-38(27-23-19-14-8-2)34-41(33-37)45-43(12-6)44(30-17-11-5)46(48(45)47)42-35-39(28-24-20-15-9-3)32-40(36-42)29-25-21-16-10-4/h31-36H,7-30H2,1-6H3 |
| InChIKey | TYUZYKGRKPHROK-UHFFFAOYSA-N |
| XLogP | 14.95 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.10 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|