C41H58N2 — CID 87817332
[2-(2-dodec-4-ynylphenyl)-3-octyl-5-(4-pentylphenyl)pyrrol-1-ium-1-ylidene]azanide (PubChem CID 87817332) has the molecular formula C41H58N2 and a molecular weight of 578.93 g/mol. Its IUPAC name is [2-(2-dodec-4-ynylphenyl)-3-octyl-5-(4-pentylphenyl)pyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [2-(2-dodec-4-ynylphenyl)-3-octyl-5-(4-pentylphenyl)pyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87817332 |
| Molecular Formula | C41H58N2 |
| Molecular Weight | 578.93 g/mol |
| Exact Mass | 578.46 |
| IUPAC Name | [2-(2-dodec-4-ynylphenyl)-3-octyl-5-(4-pentylphenyl)pyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCCC#CCCCc1ccccc1C1=C(CCCCCCCC)C=C(c2ccc(CCCCC)cc2)[N+]1=[N-] |
| InChI | InChI=1S/C41H58N2/c1-4-7-10-12-14-15-16-17-19-21-26-36-27-23-24-29-39(36)41-38(28-22-18-13-11-8-5-2)34-40(43(41)42)37-32-30-35(31-33-37)25-20-9-6-3/h23-24,27,29-34H,4-15,18-22,25-26,28H2,1-3H3 |
| InChIKey | NPAHVIJBVNHGBX-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.93 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|