C42H60N2 — CID 87819274
[3-dec-1-ynyl-2-(3,5-dihexylphenyl)-5-(3,5-dimethylphenyl)-4-ethylpyrrol-1-ium-1-ylidene]azanide (PubChem CID 87819274) has the molecular formula C42H60N2 and a molecular weight of 592.96 g/mol. Its IUPAC name is [3-dec-1-ynyl-2-(3,5-dihexylphenyl)-5-(3,5-dimethylphenyl)-4-ethylpyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [3-dec-1-ynyl-2-(3,5-dihexylphenyl)-5-(3,5-dimethylphenyl)-4-ethylpyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87819274 |
| Molecular Formula | C42H60N2 |
| Molecular Weight | 592.96 g/mol |
| Exact Mass | 592.48 |
| IUPAC Name | [3-dec-1-ynyl-2-(3,5-dihexylphenyl)-5-(3,5-dimethylphenyl)-4-ethylpyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCCCC#CC1=C(c2cc(CCCCCC)cc(CCCCCC)c2)[N+](=[N-])C(c2cc(C)cc(C)c2)=C1CC |
| InChI | InChI=1S/C42H60N2/c1-7-11-14-17-18-19-20-23-26-40-39(10-4)41(37-28-33(5)27-34(6)29-37)44(43)42(40)38-31-35(24-21-15-12-8-2)30-36(32-38)25-22-16-13-9-3/h27-32H,7-22,24-25H2,1-6H3 |
| InChIKey | KQBMGQDNYBADMJ-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.96 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|