C28H36N2Pd — CID 87821294
[3-butyl-2,5-bis(3-butylphenyl)pyrrol-1-ium-1-ylidene]azanide;palladium (PubChem CID 87821294) has the molecular formula C28H36N2Pd and a molecular weight of 507.03 g/mol. Its IUPAC name is [3-butyl-2,5-bis(3-butylphenyl)pyrrol-1-ium-1-ylidene]azanide;palladium.
| Compound Name | [3-butyl-2,5-bis(3-butylphenyl)pyrrol-1-ium-1-ylidene]azanide;palladium |
|---|---|
| PubChem CID | 87821294 |
| Molecular Formula | C28H36N2Pd |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | [3-butyl-2,5-bis(3-butylphenyl)pyrrol-1-ium-1-ylidene]azanide;palladium |
| SMILES | CCCCC1=C(c2cccc(CCCC)c2)[N+](=[N-])C(c2cccc(CCCC)c2)=C1.[Pd] |
| InChI | InChI=1S/C28H36N2.Pd/c1-4-7-12-22-14-10-17-24(19-22)27-21-26(16-9-6-3)28(30(27)29)25-18-11-15-23(20-25)13-8-5-2;/h10-11,14-15,17-21H,4-9,12-13,16H2,1-3H3; |
| InChIKey | GUPIWNLKGWMKMS-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|