C26H32N2Ni — CID 87822050
[5-(3-butylphenyl)-2-(3-methylphenyl)-3-pentylpyrrol-1-ium-1-ylidene]azanide;nickel (PubChem CID 87822050) has the molecular formula C26H32N2Ni and a molecular weight of 431.25 g/mol. Its IUPAC name is [5-(3-butylphenyl)-2-(3-methylphenyl)-3-pentylpyrrol-1-ium-1-ylidene]azanide;nickel.
| Compound Name | [5-(3-butylphenyl)-2-(3-methylphenyl)-3-pentylpyrrol-1-ium-1-ylidene]azanide;nickel |
|---|---|
| PubChem CID | 87822050 |
| Molecular Formula | C26H32N2Ni |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [5-(3-butylphenyl)-2-(3-methylphenyl)-3-pentylpyrrol-1-ium-1-ylidene]azanide;nickel |
| SMILES | CCCCCC1=C(c2cccc(C)c2)[N+](=[N-])C(c2cccc(CCCC)c2)=C1.[Ni] |
| InChI | InChI=1S/C26H32N2.Ni/c1-4-6-8-14-24-19-25(22-15-10-13-21(18-22)12-7-5-2)28(27)26(24)23-16-9-11-20(3)17-23;/h9-11,13,15-19H,4-8,12,14H2,1-3H3; |
| InChIKey | FPSIMMQTCQFHIM-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|