C27H34N2 — CID 87821978
[2,5-bis(3-methylphenyl)-3-nonylpyrrol-1-ium-1-ylidene]azanide (PubChem CID 87821978) has the molecular formula C27H34N2 and a molecular weight of 386.58 g/mol. Its IUPAC name is [2,5-bis(3-methylphenyl)-3-nonylpyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [2,5-bis(3-methylphenyl)-3-nonylpyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87821978 |
| Molecular Formula | C27H34N2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | [2,5-bis(3-methylphenyl)-3-nonylpyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCCCCC1=C(c2cccc(C)c2)[N+](=[N-])C(c2cccc(C)c2)=C1 |
| InChI | InChI=1S/C27H34N2/c1-4-5-6-7-8-9-10-15-25-20-26(23-16-11-13-21(2)18-23)29(28)27(25)24-17-12-14-22(3)19-24/h11-14,16-20H,4-10,15H2,1-3H3 |
| InChIKey | KJDKCCRRRRAMSF-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|