C30H40N2 — CID 87833925
[5-(3-methylphenyl)-2-(4-octylphenyl)-3-pentylpyrrol-1-ium-1-ylidene]azanide (PubChem CID 87833925) has the molecular formula C30H40N2 and a molecular weight of 428.66 g/mol. Its IUPAC name is [5-(3-methylphenyl)-2-(4-octylphenyl)-3-pentylpyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [5-(3-methylphenyl)-2-(4-octylphenyl)-3-pentylpyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87833925 |
| Molecular Formula | C30H40N2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | [5-(3-methylphenyl)-2-(4-octylphenyl)-3-pentylpyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCCCc1ccc(C2=C(CCCCC)C=C(c3cccc(C)c3)[N+]2=[N-])cc1 |
| InChI | InChI=1S/C30H40N2/c1-4-6-8-9-10-12-15-25-18-20-26(21-19-25)30-28(16-11-7-5-2)23-29(32(30)31)27-17-13-14-24(3)22-27/h13-14,17-23H,4-12,15-16H2,1-3H3 |
| InChIKey | MEBYIVBNBDDVGM-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|