C12H29NO6P2 — CID 87825623
[1,2-diethyl-2-[ethyl(2-phosphonoethyl)amino]butyl]phosphonic acid (PubChem CID 87825623) has the molecular formula C12H29NO6P2 and a molecular weight of 345.31 g/mol. Its IUPAC name is [1,2-diethyl-2-[ethyl(2-phosphonoethyl)amino]butyl]phosphonic acid.
| Compound Name | [1,2-diethyl-2-[ethyl(2-phosphonoethyl)amino]butyl]phosphonic acid |
|---|---|
| PubChem CID | 87825623 |
| Molecular Formula | C12H29NO6P2 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | [1,2-diethyl-2-[ethyl(2-phosphonoethyl)amino]butyl]phosphonic acid |
| SMILES | CCC(C(CC)(CC)N(CC)CCP(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H29NO6P2/c1-5-11(21(17,18)19)12(6-2,7-3)13(8-4)9-10-20(14,15)16/h11H,5-10H2,1-4H3,(H2,14,15,16)(H2,17,18,19) |
| InChIKey | WMPMHJCNEMSTIM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|