C38H51N5O8 — CID 87828264
(2,5-dioxopyrrolidin-1-yl) 4-[4-[4-benzyl-5-[2,3-dihydro-1H-inden-1-yl(hydroxy)amino]-2-hydroxy-5-oxopentyl]-3-(tert-butylcarbamoyl)piperazin-1-yl]butanoate (PubChem CID 87828264) has the molecular formula C38H51N5O8 and a molecular weight of 705.85 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[4-[4-benzyl-5-[2,3-dihydro-1H-inden-1-yl(hydroxy)amino]-2-hydroxy-5-oxopentyl]-3-(tert-butylcarbamoyl)piperazin-1-yl]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[4-[4-benzyl-5-[2,3-dihydro-1H-inden-1-yl(hydroxy)amino]-2-hydroxy-5-oxopentyl]-3-(tert-butylcarbamoyl)piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 87828264 |
| Molecular Formula | C38H51N5O8 |
| Molecular Weight | 705.85 g/mol |
| Exact Mass | 705.37 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[4-[4-benzyl-5-[2,3-dihydro-1H-inden-1-yl(hydroxy)amino]-2-hydroxy-5-oxopentyl]-3-(tert-butylcarbamoyl)piperazin-1-yl]butanoate |
| SMILES | CC(C)(C)NC(=O)C1CN(CCCC(=O)ON2C(=O)CCC2=O)CCN1CC(O)CC(Cc1ccccc1)C(=O)N(O)C1CCc2ccccc21 |
| InChI | InChI=1S/C38H51N5O8/c1-38(2,3)39-36(48)32-25-40(19-9-14-35(47)51-43-33(45)17-18-34(43)46)20-21-41(32)24-29(44)23-28(22-26-10-5-4-6-11-26)37(49)42(50)31-16-15-27-12-7-8-13-30(27)31/h4-8,10-13,28-29,31-32,44,50H,9,14-25H2,1-3H3,(H,39,48) |
| InChIKey | WXUZJKWMYGXNRH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 160.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|