C26H48HfN2Si2-2 — CID 87830264
bis(N-[cyclopenta-1,4-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine);hafnium (PubChem CID 87830264) has the molecular formula C26H48HfN2Si2-2 and a molecular weight of 623.35 g/mol. Its IUPAC name is bis(N-[cyclopenta-1,4-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine);hafnium.
| Compound Name | bis(N-[cyclopenta-1,4-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine);hafnium |
|---|---|
| PubChem CID | 87830264 |
| Molecular Formula | C26H48HfN2Si2-2 |
| Molecular Weight | 623.35 g/mol |
| Exact Mass | 624.28 |
| IUPAC Name | bis(N-[cyclopenta-1,4-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine);hafnium |
| SMILES | CC(C)N(C(C)C)[Si](C)(C)C1=[C-]CC=C1.CC(C)N(C(C)C)[Si](C)(C)C1=[C-]CC=C1.[Hf] |
| InChI | InChI=1S/2C13H24NSi.Hf/c2*1-11(2)14(12(3)4)15(5,6)13-9-7-8-10-13;/h2*7,9,11-12H,8H2,1-6H3;/q2*-1; |
| InChIKey | WRGYWIUGQBEPPY-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.35 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|