About azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol
azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol (PubChem CID 87831314) has the molecular formula C10H26N2O4
and a molecular weight of 238.33 g/mol. Its IUPAC name is azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol.
Molecular Properties
| Compound Name | azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol |
| PubChem CID | 87831314 |
| Molecular Formula | C10H26N2O4 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol |
| SMILES | N.N.OCCC(CCO)=C(CCO)CCO |
| InChI | InChI=1S/C10H20O4.2H3N/c11-5-1-9(2-6-12)10(3-7-13)4-8-14;;/h11-14H,1-8H2;2*1H3 |
| InChIKey | NTGGJKQSHQIYSA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 150.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol?
The IUPAC name of azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol (CID 87831314) is azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol.
What is the SMILES notation for azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol?
The canonical SMILES for azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol is N.N.OCCC(CCO)=C(CCO)CCO.
What is the InChIKey of azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol?
The InChIKey is NTGGJKQSHQIYSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4.2H3N/c11-5-1-9(2-6-12)10(3-7-13)4-8-14;;/h11-14H,1-8H2;2*1H3.
What are the key properties of azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol?
azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol has a molecular weight of 238.33 g/mol, XLogP of 0.14, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol is sourced from PubChem (CID 87831314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).