C31H33F2N3O4 — CID 87832368
[cyclohexyl-[4-(3,5-difluorophenyl)-2-[(2,4,6-trimethylphenyl)carbamoylamino]benzoyl]amino] acetate (PubChem CID 87832368) has the molecular formula C31H33F2N3O4 and a molecular weight of 549.62 g/mol. Its IUPAC name is [cyclohexyl-[4-(3,5-difluorophenyl)-2-[(2,4,6-trimethylphenyl)carbamoylamino]benzoyl]amino] acetate.
| Compound Name | [cyclohexyl-[4-(3,5-difluorophenyl)-2-[(2,4,6-trimethylphenyl)carbamoylamino]benzoyl]amino] acetate |
|---|---|
| PubChem CID | 87832368 |
| Molecular Formula | C31H33F2N3O4 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | [cyclohexyl-[4-(3,5-difluorophenyl)-2-[(2,4,6-trimethylphenyl)carbamoylamino]benzoyl]amino] acetate |
| SMILES | CC(=O)ON(C(=O)c1ccc(-c2cc(F)cc(F)c2)cc1NC(=O)Nc1c(C)cc(C)cc1C)C1CCCCC1 |
| InChI | InChI=1S/C31H33F2N3O4/c1-18-12-19(2)29(20(3)13-18)35-31(39)34-28-16-22(23-14-24(32)17-25(33)15-23)10-11-27(28)30(38)36(40-21(4)37)26-8-6-5-7-9-26/h10-17,26H,5-9H2,1-4H3,(H2,34,35,39) |
| InChIKey | YMDMFDGFQXSYTO-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|