C16H23N5O3S2 — CID 8783306
N-[5-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide (PubChem CID 8783306) has the molecular formula C16H23N5O3S2 and a molecular weight of 397.53 g/mol. Its IUPAC name is N-[5-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide.
| Compound Name | N-[5-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 8783306 |
| Molecular Formula | C16H23N5O3S2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[5-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide |
| SMILES | CCC(=O)N(c1nnc(SCC(=O)NC(=O)NC2CCCC2)s1)C1CC1 |
| InChI | InChI=1S/C16H23N5O3S2/c1-2-13(23)21(11-7-8-11)15-19-20-16(26-15)25-9-12(22)18-14(24)17-10-5-3-4-6-10/h10-11H,2-9H2,1H3,(H2,17,18,22,24) |
| InChIKey | ZZXXOBUAZQSCEX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|