C14H20N4O2S — CID 87834607
5-[3-methoxy-4-(4-methoxyanilino)butyl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 87834607) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 5-[3-methoxy-4-(4-methoxyanilino)butyl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[3-methoxy-4-(4-methoxyanilino)butyl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 87834607 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-[3-methoxy-4-(4-methoxyanilino)butyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(NCC(CCc2nc(=S)[nH][nH]2)OC)cc1 |
| InChI | InChI=1S/C14H20N4O2S/c1-19-11-5-3-10(4-6-11)15-9-12(20-2)7-8-13-16-14(21)18-17-13/h3-6,12,15H,7-9H2,1-2H3,(H2,16,17,18,21) |
| InChIKey | OCCCMNXDKJUTJI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|