C13H16N2O3S — CID 175538809
5-[2-hydroxy-3-(4-methoxyanilino)propyl]-3H-1,3-oxazole-2-thione (PubChem CID 175538809) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 5-[2-hydroxy-3-(4-methoxyanilino)propyl]-3H-1,3-oxazole-2-thione.
| Compound Name | 5-[2-hydroxy-3-(4-methoxyanilino)propyl]-3H-1,3-oxazole-2-thione |
|---|---|
| PubChem CID | 175538809 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 5-[2-hydroxy-3-(4-methoxyanilino)propyl]-3H-1,3-oxazole-2-thione |
| SMILES | COc1ccc(NCC(O)Cc2c[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C13H16N2O3S/c1-17-11-4-2-9(3-5-11)14-7-10(16)6-12-8-15-13(19)18-12/h2-5,8,10,14,16H,6-7H2,1H3,(H,15,19) |
| InChIKey | NRTXVDLWYDXEDO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|