C14H19N3O3S — CID 175538812
4-[3-(3,5-dimethoxyanilino)-2-hydroxypropyl]-1,3-dihydroimidazole-2-thione (PubChem CID 175538812) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 4-[3-(3,5-dimethoxyanilino)-2-hydroxypropyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[3-(3,5-dimethoxyanilino)-2-hydroxypropyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 175538812 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-[3-(3,5-dimethoxyanilino)-2-hydroxypropyl]-1,3-dihydroimidazole-2-thione |
| SMILES | COc1cc(NCC(O)Cc2c[nH]c(=S)[nH]2)cc(OC)c1 |
| InChI | InChI=1S/C14H19N3O3S/c1-19-12-4-9(5-13(6-12)20-2)15-8-11(18)3-10-7-16-14(21)17-10/h4-7,11,15,18H,3,8H2,1-2H3,(H2,16,17,21) |
| InChIKey | CMPLEVANWQWDNZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|