C13H21NO6S — CID 139491459
1-(3,5-dimethoxyanilino)-2-hydroxypentane-3-sulfonic acid (PubChem CID 139491459) has the molecular formula C13H21NO6S and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-(3,5-dimethoxyanilino)-2-hydroxypentane-3-sulfonic acid.
| Compound Name | 1-(3,5-dimethoxyanilino)-2-hydroxypentane-3-sulfonic acid |
|---|---|
| PubChem CID | 139491459 |
| Molecular Formula | C13H21NO6S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-(3,5-dimethoxyanilino)-2-hydroxypentane-3-sulfonic acid |
| SMILES | CCC(C(O)CNc1cc(OC)cc(OC)c1)S(=O)(=O)O |
| InChI | InChI=1S/C13H21NO6S/c1-4-13(21(16,17)18)12(15)8-14-9-5-10(19-2)7-11(6-9)20-3/h5-7,12-15H,4,8H2,1-3H3,(H,16,17,18) |
| InChIKey | VFWMWDKXYPLRNY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|