C11H17NO5S — CID 22328435
1-(3,5-dimethoxyanilino)propane-1-sulfonic acid (PubChem CID 22328435) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-(3,5-dimethoxyanilino)propane-1-sulfonic acid.
| Compound Name | 1-(3,5-dimethoxyanilino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 22328435 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-(3,5-dimethoxyanilino)propane-1-sulfonic acid |
| SMILES | CCC(Nc1cc(OC)cc(OC)c1)S(=O)(=O)O |
| InChI | InChI=1S/C11H17NO5S/c1-4-11(18(13,14)15)12-8-5-9(16-2)7-10(6-8)17-3/h5-7,11-12H,4H2,1-3H3,(H,13,14,15) |
| InChIKey | QXHFVXIQUAOLNU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|