C18H18N2O2S — CID 175538728
5-[2-hydroxy-3-(2-phenylanilino)propyl]-3H-1,3-oxazole-2-thione (PubChem CID 175538728) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 5-[2-hydroxy-3-(2-phenylanilino)propyl]-3H-1,3-oxazole-2-thione.
| Compound Name | 5-[2-hydroxy-3-(2-phenylanilino)propyl]-3H-1,3-oxazole-2-thione |
|---|---|
| PubChem CID | 175538728 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 5-[2-hydroxy-3-(2-phenylanilino)propyl]-3H-1,3-oxazole-2-thione |
| SMILES | OC(CNc1ccccc1-c1ccccc1)Cc1c[nH]c(=S)o1 |
| InChI | InChI=1S/C18H18N2O2S/c21-14(10-15-12-20-18(23)22-15)11-19-17-9-5-4-8-16(17)13-6-2-1-3-7-13/h1-9,12,14,19,21H,10-11H2,(H,20,23) |
| InChIKey | DVNNPJUXYGWXSR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|