About 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol
1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol (PubChem CID 168639685) has the molecular formula C17H20ClNO
and a molecular weight of 289.81 g/mol. Its IUPAC name is 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol.
Molecular Properties
| Compound Name | 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol |
| PubChem CID | 168639685 |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol |
| SMILES | Cc1ccc(-c2ccccc2NCC(O)CCl)cc1C |
| InChI | InChI=1S/C17H20ClNO/c1-12-7-8-14(9-13(12)2)16-5-3-4-6-17(16)19-11-15(20)10-18/h3-9,15,19-20H,10-11H2,1-2H3 |
| InChIKey | UYOYAMDRIDPGJL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol?
The IUPAC name of 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol (CID 168639685) is 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol.
What is the SMILES notation for 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol?
The canonical SMILES for 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol is Cc1ccc(-c2ccccc2NCC(O)CCl)cc1C.
What is the InChIKey of 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol?
The InChIKey is UYOYAMDRIDPGJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClNO/c1-12-7-8-14(9-13(12)2)16-5-3-4-6-17(16)19-11-15(20)10-18/h3-9,15,19-20H,10-11H2,1-2H3.
What are the key properties of 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol?
1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol has a molecular weight of 289.81 g/mol, XLogP of 3.98, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol is sourced from PubChem (CID 168639685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).