C17H20ClNO — CID 168639685
1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol (PubChem CID 168639685) has the molecular formula C17H20ClNO and a molecular weight of 289.81 g/mol. Its IUPAC name is 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol.
| Compound Name | 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 168639685 |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-chloro-3-[2-(3,4-dimethylphenyl)anilino]propan-2-ol |
| SMILES | Cc1ccc(-c2ccccc2NCC(O)CCl)cc1C |
| InChI | InChI=1S/C17H20ClNO/c1-12-7-8-14(9-13(12)2)16-5-3-4-6-17(16)19-11-15(20)10-18/h3-9,15,19-20H,10-11H2,1-2H3 |
| InChIKey | UYOYAMDRIDPGJL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|